Boronic acid derivatives
eMolecules 137401-45-7 | 2-((tert-Butoxycarbonyl)amino)-3-ethoxy-3-oxopropanoic acid | ChemScene | MFCD09835539 | 247.247 | C10H17NO6 | 97.000 | CCOC(=O)C(NC(=O)OC(C)(C)C)C(O)=O | 25g | 572245531
2-((tert-Butoxycarbonyl)amino)-3-ethoxy-3-oxopropanoic acid | ChemScene | 137401-45-7 | MFCD09835539 | 247.247 | C10H17NO6 | 97.000 | CCOC(=O)C(NC(=O)OC(C)(C)C)C(O)=O | 25g | 572245531
eMolecules 862081-37-6 | ChemScene | 5-(4455-Tetramethyl-132-dioxaborolan-2-yl)isobenzofuran-1(3H)-one | 250mg | 559783437 | CS-W020496 | MFCD18251723 | 260.1 | C14H17BO4
ChemScene | 5-(4455-Tetramethyl-132-dioxaborolan-2-yl)isobenzofuran-1(3H)-one | 250mg | 559783437 | CS-W020496 | 862081-37-6 | MFCD18251723 | 260.100 | C14H17BO4
eMolecules 411235-57-9 | Cyclopropylboronic acid | ChemScene | MFCD04038750 | 85.900 | C3H7BO2 | 95.000 | OB(O)C1CC1 | 10g | 426142416
Cyclopropylboronic acid | ChemScene | 411235-57-9 | MFCD04038750 | 85.900 | C3H7BO2 | 95.000 | OB(O)C1CC1 | 10g | 426142416
eMolecules 850567-91-8 | 4-t-Butylcyclohexen-1-ylboronic acid | Combi-Blocks | MFCD06659856 | 182.070 | C10H19BO2 | 96.000 | CC(C)(C)C1CCC(=CC1)B(O)O | 1g | 117521381
4-t-Butylcyclohexen-1-ylboronic acid | Combi-Blocks | 850567-91-8 | MFCD06659856 | 182.070 | C10H19BO2 | 96.000 | CC(C)(C)C1CCC(=CC1)B(O)O | 1g | 117521381
eMolecules 126747-14-6 | 4-Cyanophenylboronic acid | AA Blocks LLC | MFCD01318968 | 146.940 | C7H6BNO2 | 0.000 | OB(O)c1ccc(cc1)C#N | 5g | 410147838
4-Cyanophenylboronic acid | AA Blocks LLC | 126747-14-6 | MFCD01318968 | 146.940 | C7H6BNO2 | 0.000 | OB(O)c1ccc(cc1)C#N | 5g | 410147838
Cayman Chemical OSU03012 Fatty Acids and Deriv
An analog of celecoxib that inhibits PDK-1 (IC50 = 5 µM), and therefore Akt activation, with no measurable COX-2 inhibition up to 50 µM; inhibits tumor cell growth (IC50s ~ 1.1 µM) across a panel of 60 cancer cell lines and induces apoptosis of chronic lymphocytic leukemia cells independent of bcl-2 overexpression using both caspase-dependent and independent pathways
eMolecules 951626-85-0 | TERT-BUTYL 4-(3-FLUOROPHENYL)PIPERAZINE-1-CARBOXYLATE | AstaTech | MFCD09817414 | 280.343 | C15H21FN2O2 | 95.000 | CC(C)(C)OC(=O)N1CCN(CC1)c1cccc(F)c1 | 1g | 436051856
TERT-BUTYL 4-(3-FLUOROPHENYL)PIPERAZINE-1-CARBOXYLATE | AstaTech | 951626-85-0 | MFCD09817414 | 280.343 | C15H21FN2O2 | 95.000 | CC(C)(C)OC(=O)N1CCN(CC1)c1cccc(F)c1 | 1g | 436051856
eMolecules 850567-22-5 | 3-(N-Propylaminocarbonyl)phenylboronic acid | Combi-Blocks | MFCD04038919 | 207.040 | C10H14BNO3 | 95.000 | CCCNC(=O)c1cccc(c1)B(O)O | 1g | 117522350
3-(N-Propylaminocarbonyl)phenylboronic acid | Combi-Blocks | 850567-22-5 | MFCD04038919 | 207.040 | C10H14BNO3 | 95.000 | CCCNC(=O)c1cccc(c1)B(O)O | 1g | 117522350
eMolecules 72824-04-5 | Allylboronic acid, pinacol cyclic ester | Synthonix - Stock | MFCD00013347 | 168.040 | C9H17BO2 | 95.000 | CC1(C)OB(CC=C)OC1(C)C | 5g | 459632954
Allylboronic acid, pinacol cyclic ester | Synthonix - Stock | 72824-04-5 | MFCD00013347 | 168.040 | C9H17BO2 | 95.000 | CC1(C)OB(CC=C)OC1(C)C | 5g | 459632954
Cayman Chemical 8 9EpETE Fatty Acids and Deriv
An epoxygenase pathway product produced from EPA by CYP450 both in vitro and in vivo
Cambridge Isotope Laboratories Dioxin Furan Food/Feed/QQQ Calibration Series (CS1-CS7) 7x0 25 mL
Dioxin Furan Food/Feed/QQQ Calibration Series (CS1-CS7) 7x0 25 mL
eMolecules 99769-19-4 | 3-Methoxycarbonylphenylboronic acid | Combi-Blocks | MFCD02093046 | 179.970 | C8H9BO4 | 98.000 | COC(=O)c1cccc(c1)B(O)O | 5g | 117520475
3-Methoxycarbonylphenylboronic acid | Combi-Blocks | 99769-19-4 | MFCD02093046 | 179.970 | C8H9BO4 | 98.000 | COC(=O)c1cccc(c1)B(O)O | 5g | 117520475
eMolecules 380430-52-4 | 3-Benzyloxycarbonylphenylboronic acid | Combi-Blocks | MFCD02179445 | 256.060 | C14H13BO4 | 98.000 | OB(O)c1cccc(c1)C(=O)OCc1ccccc1 | 1g | 117520482
3-Benzyloxycarbonylphenylboronic acid | Combi-Blocks | 380430-52-4 | MFCD02179445 | 256.060 | C14H13BO4 | 98.000 | OB(O)c1cccc(c1)C(=O)OCc1ccccc1 | 1g | 117520482